About (4R)-4-fluoro-2-[(1R)-5-fluorocyclohexa-2,4-dien-1-yl]pyrrolidine
(4R)-4-fluoro-2-[(1R)-5-fluorocyclohexa-2,4-dien-1-yl]pyrrolidine (PubChem CID 66694342) has the molecular formula C10H13F2N
and a molecular weight of 185.22 g/mol. Its IUPAC name is (4R)-4-fluoro-2-[(1R)-5-fluorocyclohexa-2,4-dien-1-yl]pyrrolidine.
Molecular Properties
| Compound Name | (4R)-4-fluoro-2-[(1R)-5-fluorocyclohexa-2,4-dien-1-yl]pyrrolidine |
| PubChem CID | 66694342 |
| Molecular Formula | C10H13F2N |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | (4R)-4-fluoro-2-[(1R)-5-fluorocyclohexa-2,4-dien-1-yl]pyrrolidine |
| SMILES | FC1=CC=C[C@H](C2C[C@@H](F)CN2)C1 |
| InChI | InChI=1S/C10H13F2N/c11-8-3-1-2-7(4-8)10-5-9(12)6-13-10/h1-3,7,9-10,13H,4-6H2/t7-,9+,10?/m0/s1 |
| InChIKey | QHCVFAWIIIWWSX-CEVVRISASA-N |
| XLogP | 2.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4R)-4-fluoro-2-[(1R)-5-fluorocyclohexa-2,4-dien-1-yl]pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-fluoro-2-[(1R)-5-fluorocyclohexa-2,4-dien-1-yl]pyrrolidine?
The IUPAC name of (4R)-4-fluoro-2-[(1R)-5-fluorocyclohexa-2,4-dien-1-yl]pyrrolidine (CID 66694342) is (4R)-4-fluoro-2-[(1R)-5-fluorocyclohexa-2,4-dien-1-yl]pyrrolidine.
What is the SMILES notation for (4R)-4-fluoro-2-[(1R)-5-fluorocyclohexa-2,4-dien-1-yl]pyrrolidine?
The canonical SMILES for (4R)-4-fluoro-2-[(1R)-5-fluorocyclohexa-2,4-dien-1-yl]pyrrolidine is FC1=CC=C[C@H](C2C[C@@H](F)CN2)C1.
What is the InChIKey of (4R)-4-fluoro-2-[(1R)-5-fluorocyclohexa-2,4-dien-1-yl]pyrrolidine?
The InChIKey is QHCVFAWIIIWWSX-CEVVRISASA-N. The full InChI is InChI=1S/C10H13F2N/c11-8-3-1-2-7(4-8)10-5-9(12)6-13-10/h1-3,7,9-10,13H,4-6H2/t7-,9+,10?/m0/s1.
What are the key properties of (4R)-4-fluoro-2-[(1R)-5-fluorocyclohexa-2,4-dien-1-yl]pyrrolidine?
(4R)-4-fluoro-2-[(1R)-5-fluorocyclohexa-2,4-dien-1-yl]pyrrolidine has a molecular weight of 185.22 g/mol, XLogP of 2.12, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-fluoro-2-[(1R)-5-fluorocyclohexa-2,4-dien-1-yl]pyrrolidine is sourced from PubChem (CID 66694342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).