About 5-fluoro-3-[(2R,4S)-4-fluoropyrrolidin-2-yl]cyclohexa-1,5-diene-1-carbonitrile
5-fluoro-3-[(2R,4S)-4-fluoropyrrolidin-2-yl]cyclohexa-1,5-diene-1-carbonitrile (PubChem CID 66694347) has the molecular formula C11H12F2N2
and a molecular weight of 210.23 g/mol. Its IUPAC name is 5-fluoro-3-[(2R,4S)-4-fluoropyrrolidin-2-yl]cyclohexa-1,5-diene-1-carbonitrile.
Molecular Properties
| Compound Name | 5-fluoro-3-[(2R,4S)-4-fluoropyrrolidin-2-yl]cyclohexa-1,5-diene-1-carbonitrile |
| PubChem CID | 66694347 |
| Molecular Formula | C11H12F2N2 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 5-fluoro-3-[(2R,4S)-4-fluoropyrrolidin-2-yl]cyclohexa-1,5-diene-1-carbonitrile |
| SMILES | N#CC1=CC([C@H]2C[C@H](F)CN2)CC(F)=C1 |
| InChI | InChI=1S/C11H12F2N2/c12-9-2-7(5-14)1-8(3-9)11-4-10(13)6-15-11/h1-2,8,10-11,15H,3-4,6H2/t8?,10-,11+/m0/s1 |
| InChIKey | SGEMDMOBWRVSCD-JCBFREDQSA-N |
| XLogP | 2.01 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-fluoro-3-[(2R,4S)-4-fluoropyrrolidin-2-yl]cyclohexa-1,5-diene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-3-[(2R,4S)-4-fluoropyrrolidin-2-yl]cyclohexa-1,5-diene-1-carbonitrile?
The IUPAC name of 5-fluoro-3-[(2R,4S)-4-fluoropyrrolidin-2-yl]cyclohexa-1,5-diene-1-carbonitrile (CID 66694347) is 5-fluoro-3-[(2R,4S)-4-fluoropyrrolidin-2-yl]cyclohexa-1,5-diene-1-carbonitrile.
What is the SMILES notation for 5-fluoro-3-[(2R,4S)-4-fluoropyrrolidin-2-yl]cyclohexa-1,5-diene-1-carbonitrile?
The canonical SMILES for 5-fluoro-3-[(2R,4S)-4-fluoropyrrolidin-2-yl]cyclohexa-1,5-diene-1-carbonitrile is N#CC1=CC([C@H]2C[C@H](F)CN2)CC(F)=C1.
What is the InChIKey of 5-fluoro-3-[(2R,4S)-4-fluoropyrrolidin-2-yl]cyclohexa-1,5-diene-1-carbonitrile?
The InChIKey is SGEMDMOBWRVSCD-JCBFREDQSA-N. The full InChI is InChI=1S/C11H12F2N2/c12-9-2-7(5-14)1-8(3-9)11-4-10(13)6-15-11/h1-2,8,10-11,15H,3-4,6H2/t8?,10-,11+/m0/s1.
What are the key properties of 5-fluoro-3-[(2R,4S)-4-fluoropyrrolidin-2-yl]cyclohexa-1,5-diene-1-carbonitrile?
5-fluoro-3-[(2R,4S)-4-fluoropyrrolidin-2-yl]cyclohexa-1,5-diene-1-carbonitrile has a molecular weight of 210.23 g/mol, XLogP of 2.01, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-3-[(2R,4S)-4-fluoropyrrolidin-2-yl]cyclohexa-1,5-diene-1-carbonitrile is sourced from PubChem (CID 66694347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).