C14H22N2O5S — CID 66694423
1,3-benzodioxole-4-sulfonamide;2-propylmorpholine (PubChem CID 66694423) has the molecular formula C14H22N2O5S and a molecular weight of 330.41 g/mol. Its IUPAC name is 1,3-benzodioxole-4-sulfonamide;2-propylmorpholine.
| Compound Name | 1,3-benzodioxole-4-sulfonamide;2-propylmorpholine |
|---|---|
| PubChem CID | 66694423 |
| Molecular Formula | C14H22N2O5S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 1,3-benzodioxole-4-sulfonamide;2-propylmorpholine |
| SMILES | CCCC1CNCCO1.NS(=O)(=O)c1cccc2c1OCO2 |
| InChI | InChI=1S/C7H7NO4S.C7H15NO/c8-13(9,10)6-3-1-2-5-7(6)12-4-11-5;1-2-3-7-6-8-4-5-9-7/h1-3H,4H2,(H2,8,9,10);7-8H,2-6H2,1H3 |
| InChIKey | KRQILMDZFGUWGO-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |