C35H37N3O5 — CID 6669444
3-[1-[(2S,4S)-4-(9H-fluoren-1-yl)-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-6-carbonyl]piperidin-4-yl]-1H-benzimidazol-2-one (PubChem CID 6669444) has the molecular formula C35H37N3O5 and a molecular weight of 579.70 g/mol. Its IUPAC name is 3-[1-[(2S,4S)-4-(9H-fluoren-1-yl)-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-6-carbonyl]piperidin-4-yl]-1H-benzimidazol-2-one.
| Compound Name | 3-[1-[(2S,4S)-4-(9H-fluoren-1-yl)-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-6-carbonyl]piperidin-4-yl]-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 6669444 |
| Molecular Formula | C35H37N3O5 |
| Molecular Weight | 579.70 g/mol |
| Exact Mass | 579.27 |
| IUPAC Name | 3-[1-[(2S,4S)-4-(9H-fluoren-1-yl)-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-6-carbonyl]piperidin-4-yl]-1H-benzimidazol-2-one |
| SMILES | O=C(C1=C[C@@H](c2cccc3c2Cc2ccccc2-3)C[C@@H](OCCCCO)O1)N1CCC(n2c(=O)[nH]c3ccccc32)CC1 |
| InChI | InChI=1S/C35H37N3O5/c39-18-5-6-19-42-33-22-24(27-10-7-11-28-26-9-2-1-8-23(26)20-29(27)28)21-32(43-33)34(40)37-16-14-25(15-17-37)38-31-13-4-3-12-30(31)36-35(38)41/h1-4,7-13,21,24-25,33,39H,5-6,14-20,22H2,(H,36,41)/t24-,33+/m1/s1 |
| InChIKey | QZXIZIGUPKDRPZ-IANOAQMISA-N |
| XLogP | 5.27 |
| TPSA | 96.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.70 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|