C24H36O5 — CID 66694447
(2S)-2-[(1S,3R,7S,8S,8aR)-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl]-2-methylbutanoic acid (PubChem CID 66694447) has the molecular formula C24H36O5 and a molecular weight of 404.55 g/mol. Its IUPAC name is (2S)-2-[(1S,3R,7S,8S,8aR)-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl]-2-methylbutanoic acid.
| Compound Name | (2S)-2-[(1S,3R,7S,8S,8aR)-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl]-2-methylbutanoic acid |
|---|---|
| PubChem CID | 66694447 |
| Molecular Formula | C24H36O5 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.26 |
| IUPAC Name | (2S)-2-[(1S,3R,7S,8S,8aR)-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl]-2-methylbutanoic acid |
| SMILES | CC[C@](C)(C(=O)O)[C@H]1C[C@@H](C)C=C2C=C[C@H](C)[C@H](CC[C@@H]3C[C@@H](O)CC(=O)O3)[C@@H]21 |
| InChI | InChI=1S/C24H36O5/c1-5-24(4,23(27)28)20-11-14(2)10-16-7-6-15(3)19(22(16)20)9-8-18-12-17(25)13-21(26)29-18/h6-7,10,14-15,17-20,22,25H,5,8-9,11-13H2,1-4H3,(H,27,28)/t14-,15-,17+,18+,19-,20-,22+,24-/m0/s1 |
| InChIKey | RDVSDHLBAZPHRT-FEBKRYJVSA-N |
| XLogP | 4.35 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |