C8H15NO5 — CID 66694775
(2R,3S,4R,5S)-1-ethenoxy-2-(hydroxymethyl)piperidine-3,4,5-triol (PubChem CID 66694775) has the molecular formula C8H15NO5 and a molecular weight of 205.21 g/mol. Its IUPAC name is (2R,3S,4R,5S)-1-ethenoxy-2-(hydroxymethyl)piperidine-3,4,5-triol.
| Compound Name | (2R,3S,4R,5S)-1-ethenoxy-2-(hydroxymethyl)piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 66694775 |
| Molecular Formula | C8H15NO5 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | (2R,3S,4R,5S)-1-ethenoxy-2-(hydroxymethyl)piperidine-3,4,5-triol |
| SMILES | C=CON1C[C@H](O)[C@@H](O)[C@@H](O)[C@H]1CO |
| InChI | InChI=1S/C8H15NO5/c1-2-14-9-3-6(11)8(13)7(12)5(9)4-10/h2,5-8,10-13H,1,3-4H2/t5-,6+,7+,8-/m1/s1 |
| InChIKey | PWBYBMWACPIXAX-VGRMVHKJSA-N |
| XLogP | -2.18 |
| TPSA | 93.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | -2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|