About 1-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]phenyl]ethanone
1-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]phenyl]ethanone (PubChem CID 66695356) has the molecular formula C34H34N6O
and a molecular weight of 542.69 g/mol. Its IUPAC name is 1-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]phenyl]ethanone.
Molecular Properties
| Compound Name | 1-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]phenyl]ethanone |
| PubChem CID | 66695356 |
| Molecular Formula | C34H34N6O |
| Molecular Weight | 542.69 g/mol |
| Exact Mass | 542.28 |
| IUPAC Name | 1-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]phenyl]ethanone |
| SMILES | CC(=O)c1cc(CN(Cc2ccccn2)Cc2ccccn2)cc(CN(Cc2ccccn2)Cc2ccccn2)c1 |
| InChI | InChI=1S/C34H34N6O/c1-27(41)30-19-28(21-39(23-31-10-2-6-14-35-31)24-32-11-3-7-15-36-32)18-29(20-30)22-40(25-33-12-4-8-16-37-33)26-34-13-5-9-17-38-34/h2-20H,21-26H2,1H3 |
| InChIKey | XCPZBODRIMIXGR-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 75.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 542.69 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]phenyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]phenyl]ethanone?
The IUPAC name of 1-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]phenyl]ethanone (CID 66695356) is 1-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]phenyl]ethanone.
What is the SMILES notation for 1-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]phenyl]ethanone?
The canonical SMILES for 1-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]phenyl]ethanone is CC(=O)c1cc(CN(Cc2ccccn2)Cc2ccccn2)cc(CN(Cc2ccccn2)Cc2ccccn2)c1.
What is the InChIKey of 1-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]phenyl]ethanone?
The InChIKey is XCPZBODRIMIXGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H34N6O/c1-27(41)30-19-28(21-39(23-31-10-2-6-14-35-31)24-32-11-3-7-15-36-32)18-29(20-30)22-40(25-33-12-4-8-16-37-33)26-34-13-5-9-17-38-34/h2-20H,21-26H2,1H3.
What are the key properties of 1-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]phenyl]ethanone?
1-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]phenyl]ethanone has a molecular weight of 542.69 g/mol, XLogP of 5.87, 13 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]phenyl]ethanone is sourced from PubChem (CID 66695356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).