C30H35NO4 — CID 6669553
(2R,4R)-N-(2-bicyclo[2.2.1]heptanyl)-4-(9H-fluoren-1-yl)-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 6669553) has the molecular formula C30H35NO4 and a molecular weight of 473.61 g/mol. Its IUPAC name is (2R,4R)-N-(2-bicyclo[2.2.1]heptanyl)-4-(9H-fluoren-1-yl)-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2R,4R)-N-(2-bicyclo[2.2.1]heptanyl)-4-(9H-fluoren-1-yl)-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 6669553 |
| Molecular Formula | C30H35NO4 |
| Molecular Weight | 473.61 g/mol |
| Exact Mass | 473.26 |
| IUPAC Name | (2R,4R)-N-(2-bicyclo[2.2.1]heptanyl)-4-(9H-fluoren-1-yl)-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | O=C(NC1CC2CCC1C2)C1=C[C@H](c2cccc3c2Cc2ccccc2-3)C[C@H](OCCCCO)O1 |
| InChI | InChI=1S/C30H35NO4/c32-12-3-4-13-34-29-18-22(17-28(35-29)30(33)31-27-15-19-10-11-21(27)14-19)24-8-5-9-25-23-7-2-1-6-20(23)16-26(24)25/h1-2,5-9,17,19,21-22,27,29,32H,3-4,10-16,18H2,(H,31,33)/t19?,21?,22-,27?,29+/m0/s1 |
| InChIKey | LCCFMBFISWVRJO-KEUWXPRQSA-N |
| XLogP | 5.07 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.61 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|