C14H17F3IN5 — CID 66695744
6-N-cyclopentyl-3-iodo-8-N-(3,3,3-trifluoropropyl)imidazo[1,2-b]pyridazine-6,8-diamine (PubChem CID 66695744) has the molecular formula C14H17F3IN5 and a molecular weight of 439.22 g/mol. Its IUPAC name is 6-N-cyclopentyl-3-iodo-8-N-(3,3,3-trifluoropropyl)imidazo[1,2-b]pyridazine-6,8-diamine.
| Compound Name | 6-N-cyclopentyl-3-iodo-8-N-(3,3,3-trifluoropropyl)imidazo[1,2-b]pyridazine-6,8-diamine |
|---|---|
| PubChem CID | 66695744 |
| Molecular Formula | C14H17F3IN5 |
| Molecular Weight | 439.22 g/mol |
| Exact Mass | 439.05 |
| IUPAC Name | 6-N-cyclopentyl-3-iodo-8-N-(3,3,3-trifluoropropyl)imidazo[1,2-b]pyridazine-6,8-diamine |
| SMILES | FC(F)(F)CCNc1cc(NC2CCCC2)nn2c(I)cnc12 |
| InChI | InChI=1S/C14H17F3IN5/c15-14(16,17)5-6-19-10-7-12(21-9-3-1-2-4-9)22-23-11(18)8-20-13(10)23/h7-9,19H,1-6H2,(H,21,22) |
| InChIKey | UUKGWOBKSVBPNL-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 54.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.22 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|