C14H18F3N5 — CID 66695746
6-N-cyclopentyl-8-N-(3,3,3-trifluoropropyl)imidazo[1,2-b]pyridazine-6,8-diamine (PubChem CID 66695746) has the molecular formula C14H18F3N5 and a molecular weight of 313.33 g/mol. Its IUPAC name is 6-N-cyclopentyl-8-N-(3,3,3-trifluoropropyl)imidazo[1,2-b]pyridazine-6,8-diamine.
| Compound Name | 6-N-cyclopentyl-8-N-(3,3,3-trifluoropropyl)imidazo[1,2-b]pyridazine-6,8-diamine |
|---|---|
| PubChem CID | 66695746 |
| Molecular Formula | C14H18F3N5 |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 6-N-cyclopentyl-8-N-(3,3,3-trifluoropropyl)imidazo[1,2-b]pyridazine-6,8-diamine |
| SMILES | FC(F)(F)CCNc1cc(NC2CCCC2)nn2ccnc12 |
| InChI | InChI=1S/C14H18F3N5/c15-14(16,17)5-6-18-11-9-12(20-10-3-1-2-4-10)21-22-8-7-19-13(11)22/h7-10,18H,1-6H2,(H,20,21) |
| InChIKey | KZRPSRLTZLWMEA-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 54.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|