About 2-chloro-4-methyl-1,3-thiazole-5-carboxylic acid
2-chloro-4-methyl-1,3-thiazole-5-carboxylic acid (PubChem CID 666960) has the molecular formula C5H4ClNO2S
and a molecular weight of 177.61 g/mol. Its IUPAC name is 2-chloro-4-methyl-1,3-thiazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 2-chloro-4-methyl-1,3-thiazole-5-carboxylic acid |
| PubChem CID | 666960 |
| Molecular Formula | C5H4ClNO2S |
| Molecular Weight | 177.61 g/mol |
| Exact Mass | 176.97 |
| IUPAC Name | 2-chloro-4-methyl-1,3-thiazole-5-carboxylic acid |
| SMILES | Cc1nc(Cl)sc1C(=O)O |
| InChI | InChI=1S/C5H4ClNO2S/c1-2-3(4(8)9)10-5(6)7-2/h1H3,(H,8,9) |
| InChIKey | LDUFDQVROYUUBS-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.61 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-chloro-4-methyl-1,3-thiazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-methyl-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 2-chloro-4-methyl-1,3-thiazole-5-carboxylic acid (CID 666960) is 2-chloro-4-methyl-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 2-chloro-4-methyl-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 2-chloro-4-methyl-1,3-thiazole-5-carboxylic acid is Cc1nc(Cl)sc1C(=O)O.
What is the InChIKey of 2-chloro-4-methyl-1,3-thiazole-5-carboxylic acid?
The InChIKey is LDUFDQVROYUUBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4ClNO2S/c1-2-3(4(8)9)10-5(6)7-2/h1H3,(H,8,9).
What are the key properties of 2-chloro-4-methyl-1,3-thiazole-5-carboxylic acid?
2-chloro-4-methyl-1,3-thiazole-5-carboxylic acid has a molecular weight of 177.61 g/mol, XLogP of 1.80, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-methyl-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 666960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).