C9H15N — CID 66696100
N-methyl-1,2,3,5,6,6a-hexahydropentalen-1-amine (PubChem CID 66696100) has the molecular formula C9H15N and a molecular weight of 137.23 g/mol. Its IUPAC name is N-methyl-1,2,3,5,6,6a-hexahydropentalen-1-amine.
| Compound Name | N-methyl-1,2,3,5,6,6a-hexahydropentalen-1-amine |
|---|---|
| PubChem CID | 66696100 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | N-methyl-1,2,3,5,6,6a-hexahydropentalen-1-amine |
| SMILES | CNC1CCC2=CCCC21 |
| InChI | InChI=1S/C9H15N/c1-10-9-6-5-7-3-2-4-8(7)9/h3,8-10H,2,4-6H2,1H3 |
| InChIKey | JLSCRQPJFXCCLF-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|