C34H41N5O6 — CID 6669661
8-[(2R,4R)-4-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-6-carbonyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one (PubChem CID 6669661) has the molecular formula C34H41N5O6 and a molecular weight of 615.73 g/mol. Its IUPAC name is 8-[(2R,4R)-4-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-6-carbonyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one.
| Compound Name | 8-[(2R,4R)-4-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-6-carbonyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 6669661 |
| Molecular Formula | C34H41N5O6 |
| Molecular Weight | 615.73 g/mol |
| Exact Mass | 615.31 |
| IUPAC Name | 8-[(2R,4R)-4-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-6-carbonyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one |
| SMILES | Cc1c([C@H]2C=C(C(=O)N3CCC4(CC3)C(=O)NCN4c3ccccc3)O[C@@H](OCCCCO)C2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C34H41N5O6/c1-24-30(32(42)39(36(24)2)27-13-7-4-8-14-27)25-21-28(45-29(22-25)44-20-10-9-19-40)31(41)37-17-15-34(16-18-37)33(43)35-23-38(34)26-11-5-3-6-12-26/h3-8,11-14,21,25,29,40H,9-10,15-20,22-23H2,1-2H3,(H,35,43)/t25-,29+/m0/s1 |
| InChIKey | MXKMJABVLKIATH-ABYGYWHVSA-N |
| XLogP | 2.94 |
| TPSA | 118.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.73 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|