C44H23F5N4 — CID 66696861
8,10,12,13,15-pentafluoro-2,3,5,7-tetraphenylporphyrin (PubChem CID 66696861) has the molecular formula C44H23F5N4 and a molecular weight of 702.69 g/mol. Its IUPAC name is 8,10,12,13,15-pentafluoro-2,3,5,7-tetraphenylporphyrin.
| Compound Name | 8,10,12,13,15-pentafluoro-2,3,5,7-tetraphenylporphyrin |
|---|---|
| PubChem CID | 66696861 |
| Molecular Formula | C44H23F5N4 |
| Molecular Weight | 702.69 g/mol |
| Exact Mass | 702.18 |
| IUPAC Name | 8,10,12,13,15-pentafluoro-2,3,5,7-tetraphenylporphyrin |
| SMILES | FC1=C(F)/C2=C(\F)C3=N/C(=C\C4=N/C(=C(/c5ccccc5)C5=N/C(=C(/F)C1=N2)C(F)=C5c1ccccc1)C(c1ccccc1)=C4c1ccccc1)C=C3 |
| InChI | InChI=1S/C44H23F5N4/c45-35-29-22-21-28(50-29)23-30-31(24-13-5-1-6-14-24)32(25-15-7-2-8-16-25)40(51-30)34(27-19-11-4-12-20-27)41-33(26-17-9-3-10-18-26)36(46)43(52-41)39(49)44-38(48)37(47)42(35)53-44/h1-23H/b28-23-,30-23-,35-29+,40-34-,41-34-,42-35+,43-39+,44-39+ |
| InChIKey | JZSVQONDVDHIFC-MDXNAQPPSA-N |
| XLogP | 11.17 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.69 |
| LogP ≤ 5 | 11.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|