C29H19FN4O4S — CID 66696925
4-[12-fluoro-8-(4-methylphenyl)sulfonyl-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaen-13-yl]benzoic acid (PubChem CID 66696925) has the molecular formula C29H19FN4O4S and a molecular weight of 538.56 g/mol. Its IUPAC name is 4-[12-fluoro-8-(4-methylphenyl)sulfonyl-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaen-13-yl]benzoic acid.
| Compound Name | 4-[12-fluoro-8-(4-methylphenyl)sulfonyl-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaen-13-yl]benzoic acid |
|---|---|
| PubChem CID | 66696925 |
| Molecular Formula | C29H19FN4O4S |
| Molecular Weight | 538.56 g/mol |
| Exact Mass | 538.11 |
| IUPAC Name | 4-[12-fluoro-8-(4-methylphenyl)sulfonyl-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaen-13-yl]benzoic acid |
| SMILES | Cc1ccc(S(=O)(=O)n2c3cnc(-c4cccnc4)cc3c3c(-c4ccc(C(=O)O)cc4)c(F)cnc32)cc1 |
| InChI | InChI=1S/C29H19FN4O4S/c1-17-4-10-21(11-5-17)39(37,38)34-25-16-32-24(20-3-2-12-31-14-20)13-22(25)27-26(23(30)15-33-28(27)34)18-6-8-19(9-7-18)29(35)36/h2-16H,1H3,(H,35,36) |
| InChIKey | NHIADUMKQGGCOC-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.56 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |