C22H14FIN4O2S — CID 66696937
12-fluoro-13-iodo-8-(4-methylphenyl)sulfonyl-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene (PubChem CID 66696937) has the molecular formula C22H14FIN4O2S and a molecular weight of 544.35 g/mol. Its IUPAC name is 12-fluoro-13-iodo-8-(4-methylphenyl)sulfonyl-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene.
| Compound Name | 12-fluoro-13-iodo-8-(4-methylphenyl)sulfonyl-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene |
|---|---|
| PubChem CID | 66696937 |
| Molecular Formula | C22H14FIN4O2S |
| Molecular Weight | 544.35 g/mol |
| Exact Mass | 543.99 |
| IUPAC Name | 12-fluoro-13-iodo-8-(4-methylphenyl)sulfonyl-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene |
| SMILES | Cc1ccc(S(=O)(=O)n2c3cnc(-c4cccnc4)cc3c3c(I)c(F)cnc32)cc1 |
| InChI | InChI=1S/C22H14FIN4O2S/c1-13-4-6-15(7-5-13)31(29,30)28-19-12-26-18(14-3-2-8-25-10-14)9-16(19)20-21(24)17(23)11-27-22(20)28/h2-12H,1H3 |
| InChIKey | YAIAVNOTFLTZDZ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 77.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.35 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|