About acetic acid;thieno[3,2-d]pyrimidine
acetic acid;thieno[3,2-d]pyrimidine (PubChem CID 66697178) has the molecular formula C8H8N2O2S
and a molecular weight of 196.23 g/mol. Its IUPAC name is acetic acid;thieno[3,2-d]pyrimidine.
Molecular Properties
| Compound Name | acetic acid;thieno[3,2-d]pyrimidine |
| PubChem CID | 66697178 |
| Molecular Formula | C8H8N2O2S |
| Molecular Weight | 196.23 g/mol |
| Exact Mass | 196.03 |
| IUPAC Name | acetic acid;thieno[3,2-d]pyrimidine |
| SMILES | CC(=O)O.c1ncc2sccc2n1 |
| InChI | InChI=1S/C6H4N2S.C2H4O2/c1-2-9-6-3-7-4-8-5(1)6;1-2(3)4/h1-4H;1H3,(H,3,4) |
| InChIKey | WGWKHTGXLYWSAI-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.23 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze acetic acid;thieno[3,2-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;thieno[3,2-d]pyrimidine?
The IUPAC name of acetic acid;thieno[3,2-d]pyrimidine (CID 66697178) is acetic acid;thieno[3,2-d]pyrimidine.
What is the SMILES notation for acetic acid;thieno[3,2-d]pyrimidine?
The canonical SMILES for acetic acid;thieno[3,2-d]pyrimidine is CC(=O)O.c1ncc2sccc2n1.
What is the InChIKey of acetic acid;thieno[3,2-d]pyrimidine?
The InChIKey is WGWKHTGXLYWSAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N2S.C2H4O2/c1-2-9-6-3-7-4-8-5(1)6;1-2(3)4/h1-4H;1H3,(H,3,4).
What are the key properties of acetic acid;thieno[3,2-d]pyrimidine?
acetic acid;thieno[3,2-d]pyrimidine has a molecular weight of 196.23 g/mol, XLogP of 1.78, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;thieno[3,2-d]pyrimidine is sourced from PubChem (CID 66697178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).