C11H12N2O2S — CID 66697344
1,3-dimethyl-5-prop-2-enylthieno[2,3-d]pyrimidine-2,4-dione (PubChem CID 66697344) has the molecular formula C11H12N2O2S and a molecular weight of 236.30 g/mol. Its IUPAC name is 1,3-dimethyl-5-prop-2-enylthieno[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 1,3-dimethyl-5-prop-2-enylthieno[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 66697344 |
| Molecular Formula | C11H12N2O2S |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | 1,3-dimethyl-5-prop-2-enylthieno[2,3-d]pyrimidine-2,4-dione |
| SMILES | C=CCc1csc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C11H12N2O2S/c1-4-5-7-6-16-10-8(7)9(14)12(2)11(15)13(10)3/h4,6H,1,5H2,2-3H3 |
| InChIKey | QWTKFMUZOGDHTR-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|