About ethoxyethane;1,2,3-triethyl-4-phenylbenzene
ethoxyethane;1,2,3-triethyl-4-phenylbenzene (PubChem CID 66697424) has the molecular formula C22H32O
and a molecular weight of 312.50 g/mol. Its IUPAC name is ethoxyethane;1,2,3-triethyl-4-phenylbenzene.
Molecular Properties
| Compound Name | ethoxyethane;1,2,3-triethyl-4-phenylbenzene |
| PubChem CID | 66697424 |
| Molecular Formula | C22H32O |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | ethoxyethane;1,2,3-triethyl-4-phenylbenzene |
| SMILES | CCOCC.CCc1ccc(-c2ccccc2)c(CC)c1CC |
| InChI | InChI=1S/C18H22.C4H10O/c1-4-14-12-13-18(15-10-8-7-9-11-15)17(6-3)16(14)5-2;1-3-5-4-2/h7-13H,4-6H2,1-3H3;3-4H2,1-2H3 |
| InChIKey | KWFZIJKDVGMPFH-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethoxyethane;1,2,3-triethyl-4-phenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxyethane;1,2,3-triethyl-4-phenylbenzene?
The IUPAC name of ethoxyethane;1,2,3-triethyl-4-phenylbenzene (CID 66697424) is ethoxyethane;1,2,3-triethyl-4-phenylbenzene.
What is the SMILES notation for ethoxyethane;1,2,3-triethyl-4-phenylbenzene?
The canonical SMILES for ethoxyethane;1,2,3-triethyl-4-phenylbenzene is CCOCC.CCc1ccc(-c2ccccc2)c(CC)c1CC.
What is the InChIKey of ethoxyethane;1,2,3-triethyl-4-phenylbenzene?
The InChIKey is KWFZIJKDVGMPFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22.C4H10O/c1-4-14-12-13-18(15-10-8-7-9-11-15)17(6-3)16(14)5-2;1-3-5-4-2/h7-13H,4-6H2,1-3H3;3-4H2,1-2H3.
What are the key properties of ethoxyethane;1,2,3-triethyl-4-phenylbenzene?
ethoxyethane;1,2,3-triethyl-4-phenylbenzene has a molecular weight of 312.50 g/mol, XLogP of 6.08, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxyethane;1,2,3-triethyl-4-phenylbenzene is sourced from PubChem (CID 66697424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).