C32H36Cl3N3O3S — CID 66697761
N-[3-(3-aminopropoxy)-4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)thiophene-2-carbonyl]-4-cyclohexylpiperidine-4-carboxamide (PubChem CID 66697761) has the molecular formula C32H36Cl3N3O3S and a molecular weight of 649.08 g/mol. Its IUPAC name is N-[3-(3-aminopropoxy)-4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)thiophene-2-carbonyl]-4-cyclohexylpiperidine-4-carboxamide.
| Compound Name | N-[3-(3-aminopropoxy)-4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)thiophene-2-carbonyl]-4-cyclohexylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 66697761 |
| Molecular Formula | C32H36Cl3N3O3S |
| Molecular Weight | 649.08 g/mol |
| Exact Mass | 647.15 |
| IUPAC Name | N-[3-(3-aminopropoxy)-4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)thiophene-2-carbonyl]-4-cyclohexylpiperidine-4-carboxamide |
| SMILES | NCCCOc1c(C(=O)NC(=O)C2(C3CCCCC3)CCNCC2)sc(-c2ccc(Cl)cc2Cl)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C32H36Cl3N3O3S/c33-22-9-7-20(8-10-22)26-27(41-18-4-15-36)29(42-28(26)24-12-11-23(34)19-25(24)35)30(39)38-31(40)32(13-16-37-17-14-32)21-5-2-1-3-6-21/h7-12,19,21,37H,1-6,13-18,36H2,(H,38,39,40) |
| InChIKey | SAEYFGJHIOABTK-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.08 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|