About [4-[2-[4-(4-tert-butylphenoxy)carbonyloxyphenyl]propan-2-yl]phenyl] (4-tert-butylphenyl) carbonate
[4-[2-[4-(4-tert-butylphenoxy)carbonyloxyphenyl]propan-2-yl]phenyl] (4-tert-butylphenyl) carbonate (PubChem CID 66697978) has the molecular formula C37H40O6
and a molecular weight of 580.72 g/mol. Its IUPAC name is [4-[2-[4-(4-tert-butylphenoxy)carbonyloxyphenyl]propan-2-yl]phenyl] (4-tert-butylphenyl) carbonate.
Molecular Properties
| Compound Name | [4-[2-[4-(4-tert-butylphenoxy)carbonyloxyphenyl]propan-2-yl]phenyl] (4-tert-butylphenyl) carbonate |
| PubChem CID | 66697978 |
| Molecular Formula | C37H40O6 |
| Molecular Weight | 580.72 g/mol |
| Exact Mass | 580.28 |
| IUPAC Name | [4-[2-[4-(4-tert-butylphenoxy)carbonyloxyphenyl]propan-2-yl]phenyl] (4-tert-butylphenyl) carbonate |
| SMILES | CC(C)(C)c1ccc(OC(=O)Oc2ccc(C(C)(C)c3ccc(OC(=O)Oc4ccc(C(C)(C)C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C37H40O6/c1-35(2,3)25-9-17-29(18-10-25)40-33(38)42-31-21-13-27(14-22-31)37(7,8)28-15-23-32(24-16-28)43-34(39)41-30-19-11-26(12-20-30)36(4,5)6/h9-24H,1-8H3 |
| InChIKey | UZYFLDYXXKASTR-UHFFFAOYSA-N |
| XLogP | 9.76 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 580.72 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze [4-[2-[4-(4-tert-butylphenoxy)carbonyloxyphenyl]propan-2-yl]phenyl] (4-tert-butylphenyl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-[4-(4-tert-butylphenoxy)carbonyloxyphenyl]propan-2-yl]phenyl] (4-tert-butylphenyl) carbonate?
The IUPAC name of [4-[2-[4-(4-tert-butylphenoxy)carbonyloxyphenyl]propan-2-yl]phenyl] (4-tert-butylphenyl) carbonate (CID 66697978) is [4-[2-[4-(4-tert-butylphenoxy)carbonyloxyphenyl]propan-2-yl]phenyl] (4-tert-butylphenyl) carbonate.
What is the SMILES notation for [4-[2-[4-(4-tert-butylphenoxy)carbonyloxyphenyl]propan-2-yl]phenyl] (4-tert-butylphenyl) carbonate?
The canonical SMILES for [4-[2-[4-(4-tert-butylphenoxy)carbonyloxyphenyl]propan-2-yl]phenyl] (4-tert-butylphenyl) carbonate is CC(C)(C)c1ccc(OC(=O)Oc2ccc(C(C)(C)c3ccc(OC(=O)Oc4ccc(C(C)(C)C)cc4)cc3)cc2)cc1.
What is the InChIKey of [4-[2-[4-(4-tert-butylphenoxy)carbonyloxyphenyl]propan-2-yl]phenyl] (4-tert-butylphenyl) carbonate?
The InChIKey is UZYFLDYXXKASTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C37H40O6/c1-35(2,3)25-9-17-29(18-10-25)40-33(38)42-31-21-13-27(14-22-31)37(7,8)28-15-23-32(24-16-28)43-34(39)41-30-19-11-26(12-20-30)36(4,5)6/h9-24H,1-8H3.
What are the key properties of [4-[2-[4-(4-tert-butylphenoxy)carbonyloxyphenyl]propan-2-yl]phenyl] (4-tert-butylphenyl) carbonate?
[4-[2-[4-(4-tert-butylphenoxy)carbonyloxyphenyl]propan-2-yl]phenyl] (4-tert-butylphenyl) carbonate has a molecular weight of 580.72 g/mol, XLogP of 9.76, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-[4-(4-tert-butylphenoxy)carbonyloxyphenyl]propan-2-yl]phenyl] (4-tert-butylphenyl) carbonate is sourced from PubChem (CID 66697978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).