C6H10N2 — CID 66697998
1,2,3,3a,4,5-hexahydropyrrolo[3,2-b]pyrrole (PubChem CID 66697998) has the molecular formula C6H10N2 and a molecular weight of 110.16 g/mol. Its IUPAC name is 1,2,3,3a,4,5-hexahydropyrrolo[3,2-b]pyrrole.
| Compound Name | 1,2,3,3a,4,5-hexahydropyrrolo[3,2-b]pyrrole |
|---|---|
| PubChem CID | 66697998 |
| Molecular Formula | C6H10N2 |
| Molecular Weight | 110.16 g/mol |
| Exact Mass | 110.08 |
| IUPAC Name | 1,2,3,3a,4,5-hexahydropyrrolo[3,2-b]pyrrole |
| SMILES | C1=C2NCCC2NC1 |
| InChI | InChI=1S/C6H10N2/c1-3-7-6-2-4-8-5(1)6/h1,6-8H,2-4H2 |
| InChIKey | IMFIXLKZDLUQBQ-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 110.16 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |