About 3-tert-butyl-1-[[(2R,3R)-3-fluorooxolan-2-yl]methyl]pyrazol-5-amine
3-tert-butyl-1-[[(2R,3R)-3-fluorooxolan-2-yl]methyl]pyrazol-5-amine (PubChem CID 66698219) has the molecular formula C12H20FN3O
and a molecular weight of 241.31 g/mol. Its IUPAC name is 3-tert-butyl-1-[[(2R,3R)-3-fluorooxolan-2-yl]methyl]pyrazol-5-amine.
Molecular Properties
| Compound Name | 3-tert-butyl-1-[[(2R,3R)-3-fluorooxolan-2-yl]methyl]pyrazol-5-amine |
| PubChem CID | 66698219 |
| Molecular Formula | C12H20FN3O |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 3-tert-butyl-1-[[(2R,3R)-3-fluorooxolan-2-yl]methyl]pyrazol-5-amine |
| SMILES | CC(C)(C)c1cc(N)n(C[C@H]2OCC[C@H]2F)n1 |
| InChI | InChI=1S/C12H20FN3O/c1-12(2,3)10-6-11(14)16(15-10)7-9-8(13)4-5-17-9/h6,8-9H,4-5,7,14H2,1-3H3/t8-,9-/m1/s1 |
| InChIKey | LVAZGPQCYAUTNR-RKDXNWHRSA-N |
| XLogP | 1.89 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-tert-butyl-1-[[(2R,3R)-3-fluorooxolan-2-yl]methyl]pyrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-1-[[(2R,3R)-3-fluorooxolan-2-yl]methyl]pyrazol-5-amine?
The IUPAC name of 3-tert-butyl-1-[[(2R,3R)-3-fluorooxolan-2-yl]methyl]pyrazol-5-amine (CID 66698219) is 3-tert-butyl-1-[[(2R,3R)-3-fluorooxolan-2-yl]methyl]pyrazol-5-amine.
What is the SMILES notation for 3-tert-butyl-1-[[(2R,3R)-3-fluorooxolan-2-yl]methyl]pyrazol-5-amine?
The canonical SMILES for 3-tert-butyl-1-[[(2R,3R)-3-fluorooxolan-2-yl]methyl]pyrazol-5-amine is CC(C)(C)c1cc(N)n(C[C@H]2OCC[C@H]2F)n1.
What is the InChIKey of 3-tert-butyl-1-[[(2R,3R)-3-fluorooxolan-2-yl]methyl]pyrazol-5-amine?
The InChIKey is LVAZGPQCYAUTNR-RKDXNWHRSA-N. The full InChI is InChI=1S/C12H20FN3O/c1-12(2,3)10-6-11(14)16(15-10)7-9-8(13)4-5-17-9/h6,8-9H,4-5,7,14H2,1-3H3/t8-,9-/m1/s1.
What are the key properties of 3-tert-butyl-1-[[(2R,3R)-3-fluorooxolan-2-yl]methyl]pyrazol-5-amine?
3-tert-butyl-1-[[(2R,3R)-3-fluorooxolan-2-yl]methyl]pyrazol-5-amine has a molecular weight of 241.31 g/mol, XLogP of 1.89, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-1-[[(2R,3R)-3-fluorooxolan-2-yl]methyl]pyrazol-5-amine is sourced from PubChem (CID 66698219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).