C23H24O5 — CID 6669848
prop-2-enyl (2R,4R)-2-[[4-(hydroxymethyl)phenyl]methoxy]-4-phenyl-3,4-dihydro-2H-pyran-6-carboxylate (PubChem CID 6669848) has the molecular formula C23H24O5 and a molecular weight of 380.44 g/mol. Its IUPAC name is prop-2-enyl (2R,4R)-2-[[4-(hydroxymethyl)phenyl]methoxy]-4-phenyl-3,4-dihydro-2H-pyran-6-carboxylate.
| Compound Name | prop-2-enyl (2R,4R)-2-[[4-(hydroxymethyl)phenyl]methoxy]-4-phenyl-3,4-dihydro-2H-pyran-6-carboxylate |
|---|---|
| PubChem CID | 6669848 |
| Molecular Formula | C23H24O5 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | prop-2-enyl (2R,4R)-2-[[4-(hydroxymethyl)phenyl]methoxy]-4-phenyl-3,4-dihydro-2H-pyran-6-carboxylate |
| SMILES | C=CCOC(=O)C1=C[C@H](c2ccccc2)C[C@H](OCc2ccc(CO)cc2)O1 |
| InChI | InChI=1S/C23H24O5/c1-2-12-26-23(25)21-13-20(19-6-4-3-5-7-19)14-22(28-21)27-16-18-10-8-17(15-24)9-11-18/h2-11,13,20,22,24H,1,12,14-16H2/t20-,22+/m0/s1 |
| InChIKey | ULZRUAAXEZHMHN-RBBKRZOGSA-N |
| XLogP | 3.84 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|