About 15-methoxy-21,22-dihydroporphyrin
15-methoxy-21,22-dihydroporphyrin (PubChem CID 66699313) has the molecular formula C21H16N4O
and a molecular weight of 340.39 g/mol. Its IUPAC name is 15-methoxy-21,22-dihydroporphyrin.
Molecular Properties
| Compound Name | 15-methoxy-21,22-dihydroporphyrin |
| PubChem CID | 66699313 |
| Molecular Formula | C21H16N4O |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 15-methoxy-21,22-dihydroporphyrin |
| SMILES | COc1c2nc(cc3ccc(cc4ccc(cc5nc1C=C5)[nH]4)[nH]3)C=C2 |
| InChI | InChI=1S/C21H16N4O/c1-26-21-19-8-6-17(24-19)11-15-4-2-13(22-15)10-14-3-5-16(23-14)12-18-7-9-20(21)25-18/h2-12,22-23H,1H3/b13-10-,14-10-,15-11-,16-12-,17-11-,18-12-,21-19+,21-20+ |
| InChIKey | ROBSBHSWIXGKOL-YJHYENFXSA-N |
| XLogP | 4.66 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 15-methoxy-21,22-dihydroporphyrin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 15-methoxy-21,22-dihydroporphyrin?
The IUPAC name of 15-methoxy-21,22-dihydroporphyrin (CID 66699313) is 15-methoxy-21,22-dihydroporphyrin.
What is the SMILES notation for 15-methoxy-21,22-dihydroporphyrin?
The canonical SMILES for 15-methoxy-21,22-dihydroporphyrin is COc1c2nc(cc3ccc(cc4ccc(cc5nc1C=C5)[nH]4)[nH]3)C=C2.
What is the InChIKey of 15-methoxy-21,22-dihydroporphyrin?
The InChIKey is ROBSBHSWIXGKOL-YJHYENFXSA-N. The full InChI is InChI=1S/C21H16N4O/c1-26-21-19-8-6-17(24-19)11-15-4-2-13(22-15)10-14-3-5-16(23-14)12-18-7-9-20(21)25-18/h2-12,22-23H,1H3/b13-10-,14-10-,15-11-,16-12-,17-11-,18-12-,21-19+,21-20+.
What are the key properties of 15-methoxy-21,22-dihydroporphyrin?
15-methoxy-21,22-dihydroporphyrin has a molecular weight of 340.39 g/mol, XLogP of 4.66, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 15-methoxy-21,22-dihydroporphyrin is sourced from PubChem (CID 66699313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).