C9H11BClN3O2 — CID 66699827
[4-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]boronic acid;hydrochloride (PubChem CID 66699827) has the molecular formula C9H11BClN3O2 and a molecular weight of 239.47 g/mol. Its IUPAC name is [4-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]boronic acid;hydrochloride.
| Compound Name | [4-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]boronic acid;hydrochloride |
|---|---|
| PubChem CID | 66699827 |
| Molecular Formula | C9H11BClN3O2 |
| Molecular Weight | 239.47 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | [4-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]boronic acid;hydrochloride |
| SMILES | Cc1nc(-c2ccc(B(O)O)cc2)n[nH]1.Cl |
| InChI | InChI=1S/C9H10BN3O2.ClH/c1-6-11-9(13-12-6)7-2-4-8(5-3-7)10(14)15;/h2-5,14-15H,1H3,(H,11,12,13);1H |
| InChIKey | SABQKDBUNINGBJ-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.47 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|