C19H20N2O4 — CID 66700220
(5-benzyl-6-methyl-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]quinolin-8-yl) carbamate (PubChem CID 66700220) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is (5-benzyl-6-methyl-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]quinolin-8-yl) carbamate.
| Compound Name | (5-benzyl-6-methyl-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]quinolin-8-yl) carbamate |
|---|---|
| PubChem CID | 66700220 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | (5-benzyl-6-methyl-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]quinolin-8-yl) carbamate |
| SMILES | CC1CC(OC(N)=O)c2cc3c(cc2N1Cc1ccccc1)OCO3 |
| InChI | InChI=1S/C19H20N2O4/c1-12-7-16(25-19(20)22)14-8-17-18(24-11-23-17)9-15(14)21(12)10-13-5-3-2-4-6-13/h2-6,8-9,12,16H,7,10-11H2,1H3,(H2,20,22) |
| InChIKey | YSTDFQOHCSLAQR-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|