C20H18FN3O4 — CID 667009
1-(4-fluorophenyl)-6'-methoxy-1'-methylspiro[1,3-diazinane-5,3'-2,4-dihydroquinoline]-2,4,6-trione (PubChem CID 667009) has the molecular formula C20H18FN3O4 and a molecular weight of 383.38 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-6'-methoxy-1'-methylspiro[1,3-diazinane-5,3'-2,4-dihydroquinoline]-2,4,6-trione.
| Compound Name | 1-(4-fluorophenyl)-6'-methoxy-1'-methylspiro[1,3-diazinane-5,3'-2,4-dihydroquinoline]-2,4,6-trione |
|---|---|
| PubChem CID | 667009 |
| Molecular Formula | C20H18FN3O4 |
| Molecular Weight | 383.38 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 1-(4-fluorophenyl)-6'-methoxy-1'-methylspiro[1,3-diazinane-5,3'-2,4-dihydroquinoline]-2,4,6-trione |
| SMILES | COc1ccc2c(c1)CC1(CN2C)C(=O)NC(=O)N(c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C20H18FN3O4/c1-23-11-20(10-12-9-15(28-2)7-8-16(12)23)17(25)22-19(27)24(18(20)26)14-5-3-13(21)4-6-14/h3-9H,10-11H2,1-2H3,(H,22,25,27) |
| InChIKey | ISJYOGGNJNMEMJ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.38 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|