About 4-ethyl-1,3,5-trimethyl-2H-imidazole
4-ethyl-1,3,5-trimethyl-2H-imidazole (PubChem CID 66701644) has the molecular formula C8H16N2
and a molecular weight of 140.23 g/mol. Its IUPAC name is 4-ethyl-1,3,5-trimethyl-2H-imidazole.
Molecular Properties
| Compound Name | 4-ethyl-1,3,5-trimethyl-2H-imidazole |
| PubChem CID | 66701644 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | 4-ethyl-1,3,5-trimethyl-2H-imidazole |
| SMILES | CCC1=C(C)N(C)CN1C |
| InChI | InChI=1S/C8H16N2/c1-5-8-7(2)9(3)6-10(8)4/h5-6H2,1-4H3 |
| InChIKey | FYVXSXUYUNXADK-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-ethyl-1,3,5-trimethyl-2H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-1,3,5-trimethyl-2H-imidazole?
The IUPAC name of 4-ethyl-1,3,5-trimethyl-2H-imidazole (CID 66701644) is 4-ethyl-1,3,5-trimethyl-2H-imidazole.
What is the SMILES notation for 4-ethyl-1,3,5-trimethyl-2H-imidazole?
The canonical SMILES for 4-ethyl-1,3,5-trimethyl-2H-imidazole is CCC1=C(C)N(C)CN1C.
What is the InChIKey of 4-ethyl-1,3,5-trimethyl-2H-imidazole?
The InChIKey is FYVXSXUYUNXADK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2/c1-5-8-7(2)9(3)6-10(8)4/h5-6H2,1-4H3.
What are the key properties of 4-ethyl-1,3,5-trimethyl-2H-imidazole?
4-ethyl-1,3,5-trimethyl-2H-imidazole has a molecular weight of 140.23 g/mol, XLogP of 1.46, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-1,3,5-trimethyl-2H-imidazole is sourced from PubChem (CID 66701644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).