About (E)-3-[6-methyl-4,6-di(propan-2-yl)cyclohexa-2,4-dien-1-yl]prop-2-enoic acid
(E)-3-[6-methyl-4,6-di(propan-2-yl)cyclohexa-2,4-dien-1-yl]prop-2-enoic acid (PubChem CID 66701983) has the molecular formula C16H24O2
and a molecular weight of 248.37 g/mol. Its IUPAC name is (E)-3-[6-methyl-4,6-di(propan-2-yl)cyclohexa-2,4-dien-1-yl]prop-2-enoic acid.
Molecular Properties
| Compound Name | (E)-3-[6-methyl-4,6-di(propan-2-yl)cyclohexa-2,4-dien-1-yl]prop-2-enoic acid |
| PubChem CID | 66701983 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | (E)-3-[6-methyl-4,6-di(propan-2-yl)cyclohexa-2,4-dien-1-yl]prop-2-enoic acid |
| SMILES | CC(C)C1=CC(C)(C(C)C)C(/C=C/C(=O)O)C=C1 |
| InChI | InChI=1S/C16H24O2/c1-11(2)13-6-7-14(8-9-15(17)18)16(5,10-13)12(3)4/h6-12,14H,1-5H3,(H,17,18)/b9-8+ |
| InChIKey | MLVQYVRJCSIMTG-CMDGGOBGSA-N |
| XLogP | 4.06 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-[6-methyl-4,6-di(propan-2-yl)cyclohexa-2,4-dien-1-yl]prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-[6-methyl-4,6-di(propan-2-yl)cyclohexa-2,4-dien-1-yl]prop-2-enoic acid?
The IUPAC name of (E)-3-[6-methyl-4,6-di(propan-2-yl)cyclohexa-2,4-dien-1-yl]prop-2-enoic acid (CID 66701983) is (E)-3-[6-methyl-4,6-di(propan-2-yl)cyclohexa-2,4-dien-1-yl]prop-2-enoic acid.
What is the SMILES notation for (E)-3-[6-methyl-4,6-di(propan-2-yl)cyclohexa-2,4-dien-1-yl]prop-2-enoic acid?
The canonical SMILES for (E)-3-[6-methyl-4,6-di(propan-2-yl)cyclohexa-2,4-dien-1-yl]prop-2-enoic acid is CC(C)C1=CC(C)(C(C)C)C(/C=C/C(=O)O)C=C1.
What is the InChIKey of (E)-3-[6-methyl-4,6-di(propan-2-yl)cyclohexa-2,4-dien-1-yl]prop-2-enoic acid?
The InChIKey is MLVQYVRJCSIMTG-CMDGGOBGSA-N. The full InChI is InChI=1S/C16H24O2/c1-11(2)13-6-7-14(8-9-15(17)18)16(5,10-13)12(3)4/h6-12,14H,1-5H3,(H,17,18)/b9-8+.
What are the key properties of (E)-3-[6-methyl-4,6-di(propan-2-yl)cyclohexa-2,4-dien-1-yl]prop-2-enoic acid?
(E)-3-[6-methyl-4,6-di(propan-2-yl)cyclohexa-2,4-dien-1-yl]prop-2-enoic acid has a molecular weight of 248.37 g/mol, XLogP of 4.06, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-[6-methyl-4,6-di(propan-2-yl)cyclohexa-2,4-dien-1-yl]prop-2-enoic acid is sourced from PubChem (CID 66701983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).