About biphenylene;ethoxyethane
biphenylene;ethoxyethane (PubChem CID 66702498) has the molecular formula C16H18O
and a molecular weight of 226.32 g/mol. Its IUPAC name is biphenylene;ethoxyethane.
Molecular Properties
| Compound Name | biphenylene;ethoxyethane |
| PubChem CID | 66702498 |
| Molecular Formula | C16H18O |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | biphenylene;ethoxyethane |
| SMILES | CCOCC.c1ccc2c(c1)-c1ccccc1-2 |
| InChI | InChI=1S/C12H8.C4H10O/c1-2-6-10-9(5-1)11-7-3-4-8-12(10)11;1-3-5-4-2/h1-8H;3-4H2,1-2H3 |
| InChIKey | XEALCHWLPOSCQD-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze biphenylene;ethoxyethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of biphenylene;ethoxyethane?
The IUPAC name of biphenylene;ethoxyethane (CID 66702498) is biphenylene;ethoxyethane.
What is the SMILES notation for biphenylene;ethoxyethane?
The canonical SMILES for biphenylene;ethoxyethane is CCOCC.c1ccc2c(c1)-c1ccccc1-2.
What is the InChIKey of biphenylene;ethoxyethane?
The InChIKey is XEALCHWLPOSCQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8.C4H10O/c1-2-6-10-9(5-1)11-7-3-4-8-12(10)11;1-3-5-4-2/h1-8H;3-4H2,1-2H3.
What are the key properties of biphenylene;ethoxyethane?
biphenylene;ethoxyethane has a molecular weight of 226.32 g/mol, XLogP of 4.38, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for biphenylene;ethoxyethane is sourced from PubChem (CID 66702498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).