C26H28N2O6 — CID 6670255
(2S,4S)-4-(1-acetylindol-3-yl)-2-(4-hydroxybutoxy)-N-(2-hydroxyphenyl)-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 6670255) has the molecular formula C26H28N2O6 and a molecular weight of 464.52 g/mol. Its IUPAC name is (2S,4S)-4-(1-acetylindol-3-yl)-2-(4-hydroxybutoxy)-N-(2-hydroxyphenyl)-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2S,4S)-4-(1-acetylindol-3-yl)-2-(4-hydroxybutoxy)-N-(2-hydroxyphenyl)-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 6670255 |
| Molecular Formula | C26H28N2O6 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | (2S,4S)-4-(1-acetylindol-3-yl)-2-(4-hydroxybutoxy)-N-(2-hydroxyphenyl)-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | CC(=O)n1cc([C@@H]2C=C(C(=O)Nc3ccccc3O)O[C@H](OCCCCO)C2)c2ccccc21 |
| InChI | InChI=1S/C26H28N2O6/c1-17(30)28-16-20(19-8-2-4-10-22(19)28)18-14-24(34-25(15-18)33-13-7-6-12-29)26(32)27-21-9-3-5-11-23(21)31/h2-5,8-11,14,16,18,25,29,31H,6-7,12-13,15H2,1H3,(H,27,32)/t18-,25+/m1/s1 |
| InChIKey | RYUGFEROAZHZOF-CJAUYULYSA-N |
| XLogP | 4.15 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|