C31H43Cl2N3O5S — CID 66703322
2-[2-[(2,4-dichlorophenyl)sulfonyl-methylamino]ethoxy]-N-[[4-(1-morpholin-4-yl-3-phenylpropyl)cyclohexyl]methyl]acetamide (PubChem CID 66703322) has the molecular formula C31H43Cl2N3O5S and a molecular weight of 640.67 g/mol. Its IUPAC name is 2-[2-[(2,4-dichlorophenyl)sulfonyl-methylamino]ethoxy]-N-[[4-(1-morpholin-4-yl-3-phenylpropyl)cyclohexyl]methyl]acetamide.
| Compound Name | 2-[2-[(2,4-dichlorophenyl)sulfonyl-methylamino]ethoxy]-N-[[4-(1-morpholin-4-yl-3-phenylpropyl)cyclohexyl]methyl]acetamide |
|---|---|
| PubChem CID | 66703322 |
| Molecular Formula | C31H43Cl2N3O5S |
| Molecular Weight | 640.67 g/mol |
| Exact Mass | 639.23 |
| IUPAC Name | 2-[2-[(2,4-dichlorophenyl)sulfonyl-methylamino]ethoxy]-N-[[4-(1-morpholin-4-yl-3-phenylpropyl)cyclohexyl]methyl]acetamide |
| SMILES | CN(CCOCC(=O)NCC1CCC(C(CCc2ccccc2)N2CCOCC2)CC1)S(=O)(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C31H43Cl2N3O5S/c1-35(42(38,39)30-14-12-27(32)21-28(30)33)15-18-41-23-31(37)34-22-25-7-10-26(11-8-25)29(36-16-19-40-20-17-36)13-9-24-5-3-2-4-6-24/h2-6,12,14,21,25-26,29H,7-11,13,15-20,22-23H2,1H3,(H,34,37) |
| InChIKey | PKSMAWURYJWVAD-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.67 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|