C27H36Cl3N3O4S — CID 66703346
N-[[4-[dimethylamino(phenyl)methyl]cyclohexyl]methyl]-2-[2-[(2,4,6-trichlorophenyl)sulfonylmethylamino]ethoxy]acetamide (PubChem CID 66703346) has the molecular formula C27H36Cl3N3O4S and a molecular weight of 605.03 g/mol. Its IUPAC name is N-[[4-[dimethylamino(phenyl)methyl]cyclohexyl]methyl]-2-[2-[(2,4,6-trichlorophenyl)sulfonylmethylamino]ethoxy]acetamide.
| Compound Name | N-[[4-[dimethylamino(phenyl)methyl]cyclohexyl]methyl]-2-[2-[(2,4,6-trichlorophenyl)sulfonylmethylamino]ethoxy]acetamide |
|---|---|
| PubChem CID | 66703346 |
| Molecular Formula | C27H36Cl3N3O4S |
| Molecular Weight | 605.03 g/mol |
| Exact Mass | 603.15 |
| IUPAC Name | N-[[4-[dimethylamino(phenyl)methyl]cyclohexyl]methyl]-2-[2-[(2,4,6-trichlorophenyl)sulfonylmethylamino]ethoxy]acetamide |
| SMILES | CN(C)C(c1ccccc1)C1CCC(CNC(=O)COCCNCS(=O)(=O)c2c(Cl)cc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C27H36Cl3N3O4S/c1-33(2)26(20-6-4-3-5-7-20)21-10-8-19(9-11-21)16-32-25(34)17-37-13-12-31-18-38(35,36)27-23(29)14-22(28)15-24(27)30/h3-7,14-15,19,21,26,31H,8-13,16-18H2,1-2H3,(H,32,34) |
| InChIKey | KXVGCJDKXSRNIU-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.03 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|