C22H27N3O3 — CID 66703773
tert-butyl N-[(2R,3R)-3-hydroxy-4-indazol-2-yl-1-phenylbutan-2-yl]carbamate (PubChem CID 66703773) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is tert-butyl N-[(2R,3R)-3-hydroxy-4-indazol-2-yl-1-phenylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,3R)-3-hydroxy-4-indazol-2-yl-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 66703773 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | tert-butyl N-[(2R,3R)-3-hydroxy-4-indazol-2-yl-1-phenylbutan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](Cc1ccccc1)[C@H](O)Cn1cc2ccccc2n1 |
| InChI | InChI=1S/C22H27N3O3/c1-22(2,3)28-21(27)23-19(13-16-9-5-4-6-10-16)20(26)15-25-14-17-11-7-8-12-18(17)24-25/h4-12,14,19-20,26H,13,15H2,1-3H3,(H,23,27)/t19-,20-/m1/s1 |
| InChIKey | HTMNYKFTDAGBHA-WOJBJXKFSA-N |
| XLogP | 3.53 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |