C21H15BrN6 — CID 66703832
4-N-[3-(4-bromophenyl)-[1,2,4]triazolo[3,4-a]phthalazin-6-yl]benzene-1,4-diamine (PubChem CID 66703832) has the molecular formula C21H15BrN6 and a molecular weight of 431.30 g/mol. Its IUPAC name is 4-N-[3-(4-bromophenyl)-[1,2,4]triazolo[3,4-a]phthalazin-6-yl]benzene-1,4-diamine.
| Compound Name | 4-N-[3-(4-bromophenyl)-[1,2,4]triazolo[3,4-a]phthalazin-6-yl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 66703832 |
| Molecular Formula | C21H15BrN6 |
| Molecular Weight | 431.30 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | 4-N-[3-(4-bromophenyl)-[1,2,4]triazolo[3,4-a]phthalazin-6-yl]benzene-1,4-diamine |
| SMILES | Nc1ccc(Nc2nn3c(-c4ccc(Br)cc4)nnc3c3ccccc23)cc1 |
| InChI | InChI=1S/C21H15BrN6/c22-14-7-5-13(6-8-14)20-25-26-21-18-4-2-1-3-17(18)19(27-28(20)21)24-16-11-9-15(23)10-12-16/h1-12H,23H2,(H,24,27) |
| InChIKey | GWUJXKYHZFWQSO-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 81.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.30 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|