C23H21N7 — CID 66703874
4-N-[3-[2-(dimethylamino)phenyl]-[1,2,4]triazolo[3,4-a]phthalazin-6-yl]benzene-1,4-diamine (PubChem CID 66703874) has the molecular formula C23H21N7 and a molecular weight of 395.47 g/mol. Its IUPAC name is 4-N-[3-[2-(dimethylamino)phenyl]-[1,2,4]triazolo[3,4-a]phthalazin-6-yl]benzene-1,4-diamine.
| Compound Name | 4-N-[3-[2-(dimethylamino)phenyl]-[1,2,4]triazolo[3,4-a]phthalazin-6-yl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 66703874 |
| Molecular Formula | C23H21N7 |
| Molecular Weight | 395.47 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | 4-N-[3-[2-(dimethylamino)phenyl]-[1,2,4]triazolo[3,4-a]phthalazin-6-yl]benzene-1,4-diamine |
| SMILES | CN(C)c1ccccc1-c1nnc2c3ccccc3c(Nc3ccc(N)cc3)nn12 |
| InChI | InChI=1S/C23H21N7/c1-29(2)20-10-6-5-9-19(20)23-27-26-22-18-8-4-3-7-17(18)21(28-30(22)23)25-16-13-11-15(24)12-14-16/h3-14H,24H2,1-2H3,(H,25,28) |
| InChIKey | FDYWCGTUSAQRQM-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 84.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.47 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|