C14H26N2O2 — CID 66703882
tert-butyl (3aS,6aR)-3a-(aminomethyl)-5-methyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate (PubChem CID 66703882) has the molecular formula C14H26N2O2 and a molecular weight of 254.37 g/mol. Its IUPAC name is tert-butyl (3aS,6aR)-3a-(aminomethyl)-5-methyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate.
| Compound Name | tert-butyl (3aS,6aR)-3a-(aminomethyl)-5-methyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 66703882 |
| Molecular Formula | C14H26N2O2 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | tert-butyl (3aS,6aR)-3a-(aminomethyl)-5-methyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate |
| SMILES | CC1C[C@H]2CN(C(=O)OC(C)(C)C)C[C@@]2(CN)C1 |
| InChI | InChI=1S/C14H26N2O2/c1-10-5-11-7-16(9-14(11,6-10)8-15)12(17)18-13(2,3)4/h10-11H,5-9,15H2,1-4H3/t10?,11-,14-/m0/s1 |
| InChIKey | GKNUQNMGOVOGNU-UCOFZHQHSA-N |
| XLogP | 2.23 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |