C11H6F2N2O3S — CID 66703989
2-amino-5-[(2,2-difluoro-1,3-benzodioxol-5-yl)methylidene]-1,3-thiazol-4-one (PubChem CID 66703989) has the molecular formula C11H6F2N2O3S and a molecular weight of 284.24 g/mol. Its IUPAC name is 2-amino-5-[(2,2-difluoro-1,3-benzodioxol-5-yl)methylidene]-1,3-thiazol-4-one.
| Compound Name | 2-amino-5-[(2,2-difluoro-1,3-benzodioxol-5-yl)methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 66703989 |
| Molecular Formula | C11H6F2N2O3S |
| Molecular Weight | 284.24 g/mol |
| Exact Mass | 284.01 |
| IUPAC Name | 2-amino-5-[(2,2-difluoro-1,3-benzodioxol-5-yl)methylidene]-1,3-thiazol-4-one |
| SMILES | NC1=NC(=O)C(=Cc2ccc3c(c2)OC(F)(F)O3)S1 |
| InChI | InChI=1S/C11H6F2N2O3S/c12-11(13)17-6-2-1-5(3-7(6)18-11)4-8-9(16)15-10(14)19-8/h1-4H,(H2,14,15,16) |
| InChIKey | FVHOTOAHHNPPPI-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.24 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|