C60H60N4 — CID 66704209
2,3,7,8,12,13,17,18-octaethyl-5,10,15,20-tetraphenylporphyrin (PubChem CID 66704209) has the molecular formula C60H60N4 and a molecular weight of 837.17 g/mol. Its IUPAC name is 2,3,7,8,12,13,17,18-octaethyl-5,10,15,20-tetraphenylporphyrin.
| Compound Name | 2,3,7,8,12,13,17,18-octaethyl-5,10,15,20-tetraphenylporphyrin |
|---|---|
| PubChem CID | 66704209 |
| Molecular Formula | C60H60N4 |
| Molecular Weight | 837.17 g/mol |
| Exact Mass | 836.48 |
| IUPAC Name | 2,3,7,8,12,13,17,18-octaethyl-5,10,15,20-tetraphenylporphyrin |
| SMILES | CCC1=C(CC)/C2=C(\c3ccccc3)C3=N/C(=C(/c4ccccc4)C4=N/C(=C(/c5ccccc5)C5=N/C(=C(/c6ccccc6)C1=N2)C(CC)=C5CC)C(CC)=C4CC)C(CC)=C3CC |
| InChI | InChI=1S/C60H60N4/c1-9-41-42(10-2)54-50(38-31-23-18-24-32-38)56-45(13-5)46(14-6)58(63-56)52(40-35-27-20-28-36-40)60-48(16-8)47(15-7)59(64-60)51(39-33-25-19-26-34-39)57-44(12-4)43(11-3)55(62-57)49(53(41)61-54)37-29-21-17-22-30-37/h17-36H,9-16H2,1-8H3/b53-49-,54-50-,55-49-,56-50-,57-51-,58-52-,59-51-,60-52- |
| InChIKey | AZBCKENITPIFJZ-CEFGTSHDSA-N |
| XLogP | 15.93 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.17 |
| LogP ≤ 5 | 15.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |