C28H34N6O8 — CID 6670442
(2S,4S)-4-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-[2-(2-hydroxyethoxy)ethoxy]-N-[2-[(5-nitro-2-pyridinyl)amino]ethyl]-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 6670442) has the molecular formula C28H34N6O8 and a molecular weight of 582.61 g/mol. Its IUPAC name is (2S,4S)-4-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-[2-(2-hydroxyethoxy)ethoxy]-N-[2-[(5-nitro-2-pyridinyl)amino]ethyl]-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2S,4S)-4-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-[2-(2-hydroxyethoxy)ethoxy]-N-[2-[(5-nitro-2-pyridinyl)amino]ethyl]-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 6670442 |
| Molecular Formula | C28H34N6O8 |
| Molecular Weight | 582.61 g/mol |
| Exact Mass | 582.24 |
| IUPAC Name | (2S,4S)-4-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-[2-(2-hydroxyethoxy)ethoxy]-N-[2-[(5-nitro-2-pyridinyl)amino]ethyl]-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | Cc1c([C@@H]2C=C(C(=O)NCCNc3ccc([N+](=O)[O-])cn3)O[C@H](OCCOCCO)C2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C28H34N6O8/c1-19-26(28(37)33(32(19)2)21-6-4-3-5-7-21)20-16-23(42-25(17-20)41-15-14-40-13-12-35)27(36)30-11-10-29-24-9-8-22(18-31-24)34(38)39/h3-9,16,18,20,25,35H,10-15,17H2,1-2H3,(H,29,31)(H,30,36)/t20-,25+/m1/s1 |
| InChIKey | UGQJZXLYYOFEQV-NLFFAJNJSA-N |
| XLogP | 1.76 |
| TPSA | 172.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.61 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|