C17H20N4O3S — CID 66704478
2-[6-[[amino(thiophen-2-yl)methylidene]amino]-2,3-dihydro-1,4-benzoxazin-4-yl]ethyl-methylcarbamic acid (PubChem CID 66704478) has the molecular formula C17H20N4O3S and a molecular weight of 360.44 g/mol. Its IUPAC name is 2-[6-[[amino(thiophen-2-yl)methylidene]amino]-2,3-dihydro-1,4-benzoxazin-4-yl]ethyl-methylcarbamic acid.
| Compound Name | 2-[6-[[amino(thiophen-2-yl)methylidene]amino]-2,3-dihydro-1,4-benzoxazin-4-yl]ethyl-methylcarbamic acid |
|---|---|
| PubChem CID | 66704478 |
| Molecular Formula | C17H20N4O3S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 2-[6-[[amino(thiophen-2-yl)methylidene]amino]-2,3-dihydro-1,4-benzoxazin-4-yl]ethyl-methylcarbamic acid |
| SMILES | CN(CCN1CCOc2ccc(/N=C(\N)c3cccs3)cc21)C(=O)O |
| InChI | InChI=1S/C17H20N4O3S/c1-20(17(22)23)6-7-21-8-9-24-14-5-4-12(11-13(14)21)19-16(18)15-3-2-10-25-15/h2-5,10-11H,6-9H2,1H3,(H2,18,19)(H,22,23) |
| InChIKey | GPHNIXQDYCBDSS-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 91.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|