C11H12ClN2O5P — CID 66704512
3-[1-[[chlorooxy(hydroxy)phosphoryl]methyl]benzimidazol-2-yl]propanoic acid (PubChem CID 66704512) has the molecular formula C11H12ClN2O5P and a molecular weight of 318.65 g/mol. Its IUPAC name is 3-[1-[[chlorooxy(hydroxy)phosphoryl]methyl]benzimidazol-2-yl]propanoic acid.
| Compound Name | 3-[1-[[chlorooxy(hydroxy)phosphoryl]methyl]benzimidazol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 66704512 |
| Molecular Formula | C11H12ClN2O5P |
| Molecular Weight | 318.65 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | 3-[1-[[chlorooxy(hydroxy)phosphoryl]methyl]benzimidazol-2-yl]propanoic acid |
| SMILES | O=C(O)CCc1nc2ccccc2n1CP(=O)(O)OCl |
| InChI | InChI=1S/C11H12ClN2O5P/c12-19-20(17,18)7-14-9-4-2-1-3-8(9)13-10(14)5-6-11(15)16/h1-4H,5-7H2,(H,15,16)(H,17,18) |
| InChIKey | LWTRQWFUUGSXFQ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.65 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|