C13H19N3O2S — CID 66704577
2-(6-amino-2,3-dihydro-1,4-benzothiazin-4-yl)ethyl-ethylcarbamic acid (PubChem CID 66704577) has the molecular formula C13H19N3O2S and a molecular weight of 281.38 g/mol. Its IUPAC name is 2-(6-amino-2,3-dihydro-1,4-benzothiazin-4-yl)ethyl-ethylcarbamic acid.
| Compound Name | 2-(6-amino-2,3-dihydro-1,4-benzothiazin-4-yl)ethyl-ethylcarbamic acid |
|---|---|
| PubChem CID | 66704577 |
| Molecular Formula | C13H19N3O2S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 2-(6-amino-2,3-dihydro-1,4-benzothiazin-4-yl)ethyl-ethylcarbamic acid |
| SMILES | CCN(CCN1CCSc2ccc(N)cc21)C(=O)O |
| InChI | InChI=1S/C13H19N3O2S/c1-2-15(13(17)18)5-6-16-7-8-19-12-4-3-10(14)9-11(12)16/h3-4,9H,2,5-8,14H2,1H3,(H,17,18) |
| InChIKey | PGQVKLHXSPZESP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 69.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|