C22H30N4O2S2 — CID 66704619
tert-butyl N-[2-[7-[[amino(thiophen-2-yl)methylidene]amino]-2,3-dihydro-1,4-benzothiazin-4-yl]ethyl]-N-ethylcarbamate (PubChem CID 66704619) has the molecular formula C22H30N4O2S2 and a molecular weight of 446.64 g/mol. Its IUPAC name is tert-butyl N-[2-[7-[[amino(thiophen-2-yl)methylidene]amino]-2,3-dihydro-1,4-benzothiazin-4-yl]ethyl]-N-ethylcarbamate.
| Compound Name | tert-butyl N-[2-[7-[[amino(thiophen-2-yl)methylidene]amino]-2,3-dihydro-1,4-benzothiazin-4-yl]ethyl]-N-ethylcarbamate |
|---|---|
| PubChem CID | 66704619 |
| Molecular Formula | C22H30N4O2S2 |
| Molecular Weight | 446.64 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | tert-butyl N-[2-[7-[[amino(thiophen-2-yl)methylidene]amino]-2,3-dihydro-1,4-benzothiazin-4-yl]ethyl]-N-ethylcarbamate |
| SMILES | CCN(CCN1CCSc2cc(/N=C(\N)c3cccs3)ccc21)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H30N4O2S2/c1-5-25(21(27)28-22(2,3)4)10-11-26-12-14-30-19-15-16(8-9-17(19)26)24-20(23)18-7-6-13-29-18/h6-9,13,15H,5,10-12,14H2,1-4H3,(H2,23,24) |
| InChIKey | BRGGSKARBSUSFU-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 71.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.64 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|