C15H25NO4 — CID 66705287
2-O-tert-butyl 3-O-ethyl 3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2,3-dicarboxylate (PubChem CID 66705287) has the molecular formula C15H25NO4 and a molecular weight of 283.37 g/mol. Its IUPAC name is 2-O-tert-butyl 3-O-ethyl 3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2,3-dicarboxylate.
| Compound Name | 2-O-tert-butyl 3-O-ethyl 3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2,3-dicarboxylate |
|---|---|
| PubChem CID | 66705287 |
| Molecular Formula | C15H25NO4 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 2-O-tert-butyl 3-O-ethyl 3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2,3-dicarboxylate |
| SMILES | CCOC(=O)C1C2CCCC2CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H25NO4/c1-5-19-13(17)12-11-8-6-7-10(11)9-16(12)14(18)20-15(2,3)4/h10-12H,5-9H2,1-4H3 |
| InChIKey | XDBOXLWVAPGGQW-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |