C15H26BN3O4 — CID 66705846
tert-butyl-[1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-3-yl]carbamic acid (PubChem CID 66705846) has the molecular formula C15H26BN3O4 and a molecular weight of 323.20 g/mol. Its IUPAC name is tert-butyl-[1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-3-yl]carbamic acid.
| Compound Name | tert-butyl-[1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-3-yl]carbamic acid |
|---|---|
| PubChem CID | 66705846 |
| Molecular Formula | C15H26BN3O4 |
| Molecular Weight | 323.20 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | tert-butyl-[1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-3-yl]carbamic acid |
| SMILES | Cn1cc(B2OC(C)(C)C(C)(C)O2)c(N(C(=O)O)C(C)(C)C)n1 |
| InChI | InChI=1S/C15H26BN3O4/c1-13(2,3)19(12(20)21)11-10(9-18(8)17-11)16-22-14(4,5)15(6,7)23-16/h9H,1-8H3,(H,20,21) |
| InChIKey | AJHGEUIUUFZXLI-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.20 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|