C14H16ClN3S — CID 66706609
N-(7-chloro-2,3,4,5-tetrahydro-1H-3-benzazepin-6-yl)-N-methyl-1,3-thiazol-5-amine (PubChem CID 66706609) has the molecular formula C14H16ClN3S and a molecular weight of 293.82 g/mol. Its IUPAC name is N-(7-chloro-2,3,4,5-tetrahydro-1H-3-benzazepin-6-yl)-N-methyl-1,3-thiazol-5-amine.
| Compound Name | N-(7-chloro-2,3,4,5-tetrahydro-1H-3-benzazepin-6-yl)-N-methyl-1,3-thiazol-5-amine |
|---|---|
| PubChem CID | 66706609 |
| Molecular Formula | C14H16ClN3S |
| Molecular Weight | 293.82 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | N-(7-chloro-2,3,4,5-tetrahydro-1H-3-benzazepin-6-yl)-N-methyl-1,3-thiazol-5-amine |
| SMILES | CN(c1cncs1)c1c(Cl)ccc2c1CCNCC2 |
| InChI | InChI=1S/C14H16ClN3S/c1-18(13-8-17-9-19-13)14-11-5-7-16-6-4-10(11)2-3-12(14)15/h2-3,8-9,16H,4-7H2,1H3 |
| InChIKey | VUWBORFLQMQKSG-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.82 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|