C24H27ClF3N3O5 — CID 66707132
butanedioic acid;4-[[(7-chloro-2,3,4,5-tetrahydro-1H-3-benzazepin-6-yl)amino]methyl]-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 66707132) has the molecular formula C24H27ClF3N3O5 and a molecular weight of 529.94 g/mol. Its IUPAC name is butanedioic acid;4-[[(7-chloro-2,3,4,5-tetrahydro-1H-3-benzazepin-6-yl)amino]methyl]-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | butanedioic acid;4-[[(7-chloro-2,3,4,5-tetrahydro-1H-3-benzazepin-6-yl)amino]methyl]-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 66707132 |
| Molecular Formula | C24H27ClF3N3O5 |
| Molecular Weight | 529.94 g/mol |
| Exact Mass | 529.16 |
| IUPAC Name | butanedioic acid;4-[[(7-chloro-2,3,4,5-tetrahydro-1H-3-benzazepin-6-yl)amino]methyl]-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | O=C(NCC(F)(F)F)c1ccc(CNc2c(Cl)ccc3c2CCNCC3)cc1.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C20H21ClF3N3O.C4H6O4/c21-17-6-5-14-7-9-25-10-8-16(14)18(17)26-11-13-1-3-15(4-2-13)19(28)27-12-20(22,23)24;5-3(6)1-2-4(7)8/h1-6,25-26H,7-12H2,(H,27,28);1-2H2,(H,5,6)(H,7,8) |
| InChIKey | WHQHPLKPRHNANZ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.94 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |