C27H33ClN2O5S — CID 66707175
butanedioic acid;1-[3-[(7-chloro-2,3,4,5-tetrahydro-1H-3-benzazepin-6-yl)sulfanyl]propyl]-3,3-dimethylindol-2-one (PubChem CID 66707175) has the molecular formula C27H33ClN2O5S and a molecular weight of 533.09 g/mol. Its IUPAC name is butanedioic acid;1-[3-[(7-chloro-2,3,4,5-tetrahydro-1H-3-benzazepin-6-yl)sulfanyl]propyl]-3,3-dimethylindol-2-one.
| Compound Name | butanedioic acid;1-[3-[(7-chloro-2,3,4,5-tetrahydro-1H-3-benzazepin-6-yl)sulfanyl]propyl]-3,3-dimethylindol-2-one |
|---|---|
| PubChem CID | 66707175 |
| Molecular Formula | C27H33ClN2O5S |
| Molecular Weight | 533.09 g/mol |
| Exact Mass | 532.18 |
| IUPAC Name | butanedioic acid;1-[3-[(7-chloro-2,3,4,5-tetrahydro-1H-3-benzazepin-6-yl)sulfanyl]propyl]-3,3-dimethylindol-2-one |
| SMILES | CC1(C)C(=O)N(CCCSc2c(Cl)ccc3c2CCNCC3)c2ccccc21.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C23H27ClN2OS.C4H6O4/c1-23(2)18-6-3-4-7-20(18)26(22(23)27)14-5-15-28-21-17-11-13-25-12-10-16(17)8-9-19(21)24;5-3(6)1-2-4(7)8/h3-4,6-9,25H,5,10-15H2,1-2H3;1-2H2,(H,5,6)(H,7,8) |
| InChIKey | HFSPJIDAZVKERN-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.09 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|